C17H28N5O4+ — CID 75608943
7-(2-hydroxy-3-piperidin-1-ylpropyl)-8-(methoxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 75608943) has the molecular formula C17H28N5O4+ and a molecular weight of 366.44 g/mol. Its IUPAC name is 7-(2-hydroxy-3-piperidin-1-ylpropyl)-8-(methoxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-(2-hydroxy-3-piperidin-1-ylpropyl)-8-(methoxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 75608943 |
| Molecular Formula | C17H28N5O4+ |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 7-(2-hydroxy-3-piperidin-1-ylpropyl)-8-(methoxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | COCC1=[N+](CC(O)CN2CCCCC2)C2C(=O)N(C)C(=O)N(C)C2=N1 |
| InChI | InChI=1S/C17H28N5O4/c1-19-15-14(16(24)20(2)17(19)25)22(13(18-15)11-26-3)10-12(23)9-21-7-5-4-6-8-21/h12,14,23H,4-11H2,1-3H3/q+1 |
| InChIKey | FCTGHVNKYVGNIT-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|