C17H28N5O4+ — CID 75608978
7-[3-(cyclohexylamino)-2-hydroxypropyl]-8-(hydroxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 75608978) has the molecular formula C17H28N5O4+ and a molecular weight of 366.44 g/mol. Its IUPAC name is 7-[3-(cyclohexylamino)-2-hydroxypropyl]-8-(hydroxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-[3-(cyclohexylamino)-2-hydroxypropyl]-8-(hydroxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 75608978 |
| Molecular Formula | C17H28N5O4+ |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 7-[3-(cyclohexylamino)-2-hydroxypropyl]-8-(hydroxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC(CO)=[N+]2CC(O)CNC2CCCCC2)N(C)C1=O |
| InChI | InChI=1S/C17H28N5O4/c1-20-15-14(16(25)21(2)17(20)26)22(13(10-23)19-15)9-12(24)8-18-11-6-4-3-5-7-11/h11-12,14,18,23-24H,3-10H2,1-2H3/q+1 |
| InChIKey | ZGUUZFQPHSWMKN-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|