C15H22N5O4+ — CID 74688301
2-[8-(cyclohexylamino)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetic acid (PubChem CID 74688301) has the molecular formula C15H22N5O4+ and a molecular weight of 336.37 g/mol. Its IUPAC name is 2-[8-(cyclohexylamino)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetic acid.
| Compound Name | 2-[8-(cyclohexylamino)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetic acid |
|---|---|
| PubChem CID | 74688301 |
| Molecular Formula | C15H22N5O4+ |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 2-[8-(cyclohexylamino)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetic acid |
| SMILES | CN1C(=O)C2C(=NC(NC3CCCCC3)=[N+]2CC(=O)O)N(C)C1=O |
| InChI | InChI=1S/C15H21N5O4/c1-18-12-11(13(23)19(2)15(18)24)20(8-10(21)22)14(17-12)16-9-6-4-3-5-7-9/h9,11H,3-8H2,1-2H3,(H,21,22)/p+1 |
| InChIKey | SKWPRXQRGAVBPY-UHFFFAOYSA-O |
| XLogP | -0.33 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|