C25H23NO5 — CID 7474192
4-[[(1R)-1-(1,3-benzodioxol-5-yl)-3-oxo-5-phenylpentyl]amino]benzoic acid (PubChem CID 7474192) has the molecular formula C25H23NO5 and a molecular weight of 417.46 g/mol. Its IUPAC name is 4-[[(1R)-1-(1,3-benzodioxol-5-yl)-3-oxo-5-phenylpentyl]amino]benzoic acid.
| Compound Name | 4-[[(1R)-1-(1,3-benzodioxol-5-yl)-3-oxo-5-phenylpentyl]amino]benzoic acid |
|---|---|
| PubChem CID | 7474192 |
| Molecular Formula | C25H23NO5 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 4-[[(1R)-1-(1,3-benzodioxol-5-yl)-3-oxo-5-phenylpentyl]amino]benzoic acid |
| SMILES | O=C(CCc1ccccc1)C[C@@H](Nc1ccc(C(=O)O)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H23NO5/c27-21(12-6-17-4-2-1-3-5-17)15-22(19-9-13-23-24(14-19)31-16-30-23)26-20-10-7-18(8-11-20)25(28)29/h1-5,7-11,13-14,22,26H,6,12,15-16H2,(H,28,29)/t22-/m1/s1 |
| InChIKey | CIHWHTVOZJVDHT-JOCHJYFZSA-N |
| XLogP | 4.86 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |