C19H27N2O3+ — CID 7474645
cyclohexyl-[(3R)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-methylazanium (PubChem CID 7474645) has the molecular formula C19H27N2O3+ and a molecular weight of 331.44 g/mol. Its IUPAC name is cyclohexyl-[(3R)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-methylazanium.
| Compound Name | cyclohexyl-[(3R)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-methylazanium |
|---|---|
| PubChem CID | 7474645 |
| Molecular Formula | C19H27N2O3+ |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | cyclohexyl-[(3R)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-methylazanium |
| SMILES | CCOc1ccc(N2C(=O)C[C@@H]([NH+](C)C3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C19H26N2O3/c1-3-24-16-11-9-15(10-12-16)21-18(22)13-17(19(21)23)20(2)14-7-5-4-6-8-14/h9-12,14,17H,3-8,13H2,1-2H3/p+1/t17-/m1/s1 |
| InChIKey | BCLPAOASVODEMF-QGZVFWFLSA-O |
| XLogP | 1.56 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|