C23H28FN3O2 — CID 74775038
[4-benzyl-4-(hydroxymethyl)piperidin-1-yl]-[3-(2-fluorophenyl)pyrazolidin-4-yl]methanone (PubChem CID 74775038) has the molecular formula C23H28FN3O2 and a molecular weight of 397.49 g/mol. Its IUPAC name is [4-benzyl-4-(hydroxymethyl)piperidin-1-yl]-[3-(2-fluorophenyl)pyrazolidin-4-yl]methanone.
| Compound Name | [4-benzyl-4-(hydroxymethyl)piperidin-1-yl]-[3-(2-fluorophenyl)pyrazolidin-4-yl]methanone |
|---|---|
| PubChem CID | 74775038 |
| Molecular Formula | C23H28FN3O2 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | [4-benzyl-4-(hydroxymethyl)piperidin-1-yl]-[3-(2-fluorophenyl)pyrazolidin-4-yl]methanone |
| SMILES | O=C(C1CNNC1c1ccccc1F)N1CCC(CO)(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H28FN3O2/c24-20-9-5-4-8-18(20)21-19(15-25-26-21)22(29)27-12-10-23(16-28,11-13-27)14-17-6-2-1-3-7-17/h1-9,19,21,25-26,28H,10-16H2 |
| InChIKey | IKTMQMLZCOPXBV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |