C19H19N4O5+ — CID 74782434
N,7-bis(furan-2-ylmethyl)-1,3-dimethyl-2,4-dioxo-4aH-pyrrolo[2,3-d]pyrimidin-7-ium-6-carboxamide (PubChem CID 74782434) has the molecular formula C19H19N4O5+ and a molecular weight of 383.38 g/mol. Its IUPAC name is N,7-bis(furan-2-ylmethyl)-1,3-dimethyl-2,4-dioxo-4aH-pyrrolo[2,3-d]pyrimidin-7-ium-6-carboxamide.
| Compound Name | N,7-bis(furan-2-ylmethyl)-1,3-dimethyl-2,4-dioxo-4aH-pyrrolo[2,3-d]pyrimidin-7-ium-6-carboxamide |
|---|---|
| PubChem CID | 74782434 |
| Molecular Formula | C19H19N4O5+ |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | N,7-bis(furan-2-ylmethyl)-1,3-dimethyl-2,4-dioxo-4aH-pyrrolo[2,3-d]pyrimidin-7-ium-6-carboxamide |
| SMILES | CN1C(=O)C2C=C(C(=O)NCc3ccco3)[N+](Cc3ccco3)=C2N(C)C1=O |
| InChI | InChI=1S/C19H18N4O5/c1-21-17-14(18(25)22(2)19(21)26)9-15(23(17)11-13-6-4-8-28-13)16(24)20-10-12-5-3-7-27-12/h3-9,14H,10-11H2,1-2H3/p+1 |
| InChIKey | PHXMXVRONMRMEF-UHFFFAOYSA-O |
| XLogP | 1.14 |
| TPSA | 99.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|