C18H23N4O4+ — CID 74782539
7-butyl-N-(furan-2-ylmethyl)-1,3-dimethyl-2,4-dioxo-4aH-pyrrolo[2,3-d]pyrimidin-7-ium-6-carboxamide (PubChem CID 74782539) has the molecular formula C18H23N4O4+ and a molecular weight of 359.41 g/mol. Its IUPAC name is 7-butyl-N-(furan-2-ylmethyl)-1,3-dimethyl-2,4-dioxo-4aH-pyrrolo[2,3-d]pyrimidin-7-ium-6-carboxamide.
| Compound Name | 7-butyl-N-(furan-2-ylmethyl)-1,3-dimethyl-2,4-dioxo-4aH-pyrrolo[2,3-d]pyrimidin-7-ium-6-carboxamide |
|---|---|
| PubChem CID | 74782539 |
| Molecular Formula | C18H23N4O4+ |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 7-butyl-N-(furan-2-ylmethyl)-1,3-dimethyl-2,4-dioxo-4aH-pyrrolo[2,3-d]pyrimidin-7-ium-6-carboxamide |
| SMILES | CCCC[N+]1=C2C(C=C1C(=O)NCc1ccco1)C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C18H22N4O4/c1-4-5-8-22-14(15(23)19-11-12-7-6-9-26-12)10-13-16(22)20(2)18(25)21(3)17(13)24/h6-7,9-10,13H,4-5,8,11H2,1-3H3/p+1 |
| InChIKey | FIUPIASVCHHMIB-UHFFFAOYSA-O |
| XLogP | 1.14 |
| TPSA | 85.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|