C17H25NO2S — CID 7478580
N-cycloheptyl-4-(2,5-dimethylthiophen-3-yl)-4-oxobutanamide (PubChem CID 7478580) has the molecular formula C17H25NO2S and a molecular weight of 307.46 g/mol. Its IUPAC name is N-cycloheptyl-4-(2,5-dimethylthiophen-3-yl)-4-oxobutanamide.
| Compound Name | N-cycloheptyl-4-(2,5-dimethylthiophen-3-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 7478580 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | N-cycloheptyl-4-(2,5-dimethylthiophen-3-yl)-4-oxobutanamide |
| SMILES | Cc1cc(C(=O)CCC(=O)NC2CCCCCC2)c(C)s1 |
| InChI | InChI=1S/C17H25NO2S/c1-12-11-15(13(2)21-12)16(19)9-10-17(20)18-14-7-5-3-4-6-8-14/h11,14H,3-10H2,1-2H3,(H,18,20) |
| InChIKey | CYFDEZWMMLCROZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |