C24H20N2O3 — CID 7481897
4-[(3R)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]-6-methoxybenzene-1,3-dicarbaldehyde (PubChem CID 7481897) has the molecular formula C24H20N2O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is 4-[(3R)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]-6-methoxybenzene-1,3-dicarbaldehyde.
| Compound Name | 4-[(3R)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]-6-methoxybenzene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 7481897 |
| Molecular Formula | C24H20N2O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 4-[(3R)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]-6-methoxybenzene-1,3-dicarbaldehyde |
| SMILES | COc1cc(N2N=C(c3ccccc3)C[C@@H]2c2ccccc2)c(C=O)cc1C=O |
| InChI | InChI=1S/C24H20N2O3/c1-29-24-14-23(19(15-27)12-20(24)16-28)26-22(18-10-6-3-7-11-18)13-21(25-26)17-8-4-2-5-9-17/h2-12,14-16,22H,13H2,1H3/t22-/m1/s1 |
| InChIKey | NNAJOFALWMPKPI-JOCHJYFZSA-N |
| XLogP | 4.68 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|