C24H22N4O3S — CID 74908698
3-(1,3-benzodioxol-5-yl)-N-(3-imidazol-1-ylpropyl)-N-(6-methyl-1,3-benzothiazol-2-yl)prop-2-enamide (PubChem CID 74908698) has the molecular formula C24H22N4O3S and a molecular weight of 446.53 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-(3-imidazol-1-ylpropyl)-N-(6-methyl-1,3-benzothiazol-2-yl)prop-2-enamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-(3-imidazol-1-ylpropyl)-N-(6-methyl-1,3-benzothiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 74908698 |
| Molecular Formula | C24H22N4O3S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-(3-imidazol-1-ylpropyl)-N-(6-methyl-1,3-benzothiazol-2-yl)prop-2-enamide |
| SMILES | Cc1ccc2nc(N(CCCn3ccnc3)C(=O)C=Cc3ccc4c(c3)OCO4)sc2c1 |
| InChI | InChI=1S/C24H22N4O3S/c1-17-3-6-19-22(13-17)32-24(26-19)28(11-2-10-27-12-9-25-15-27)23(29)8-5-18-4-7-20-21(14-18)31-16-30-20/h3-9,12-15H,2,10-11,16H2,1H3 |
| InChIKey | KJSYSAYMLFGEGS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|