C22H24O6 — CID 74929622
7-(6-methyl-8,15-dioxo-7,11-dioxatricyclo[7.6.1.012,16]hexadeca-9,13-dien-10-yl)hepta-2,4,6-trienoic acid (PubChem CID 74929622) has the molecular formula C22H24O6 and a molecular weight of 384.43 g/mol. Its IUPAC name is 7-(6-methyl-8,15-dioxo-7,11-dioxatricyclo[7.6.1.012,16]hexadeca-9,13-dien-10-yl)hepta-2,4,6-trienoic acid.
| Compound Name | 7-(6-methyl-8,15-dioxo-7,11-dioxatricyclo[7.6.1.012,16]hexadeca-9,13-dien-10-yl)hepta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 74929622 |
| Molecular Formula | C22H24O6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 7-(6-methyl-8,15-dioxo-7,11-dioxatricyclo[7.6.1.012,16]hexadeca-9,13-dien-10-yl)hepta-2,4,6-trienoic acid |
| SMILES | CC1CCCCC2C(=O)C=CC3OC(C=CC=CC=CC(=O)O)=C(C(=O)O1)C32 |
| InChI | InChI=1S/C22H24O6/c1-14-8-6-7-9-15-16(23)12-13-18-20(15)21(22(26)27-14)17(28-18)10-4-2-3-5-11-19(24)25/h2-5,10-15,18,20H,6-9H2,1H3,(H,24,25) |
| InChIKey | JNAUHZYEDHLHAJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|