C16H14ClN3O5S — CID 7495701
N-[4-chloro-3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2-nitrobenzamide (PubChem CID 7495701) has the molecular formula C16H14ClN3O5S and a molecular weight of 395.82 g/mol. Its IUPAC name is N-[4-chloro-3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2-nitrobenzamide.
| Compound Name | N-[4-chloro-3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 7495701 |
| Molecular Formula | C16H14ClN3O5S |
| Molecular Weight | 395.82 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | N-[4-chloro-3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2-nitrobenzamide |
| SMILES | O=C(Nc1ccc(Cl)c(N2CCCS2(=O)=O)c1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14ClN3O5S/c17-13-7-6-11(10-15(13)19-8-3-9-26(19,24)25)18-16(21)12-4-1-2-5-14(12)20(22)23/h1-2,4-7,10H,3,8-9H2,(H,18,21) |
| InChIKey | CSMLSLNVLBBQKA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.82 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|