C30H34N6O5S — CID 74963332
2-amino-3-cyclohexyl-N-[4-[3-(1,2,4-triazol-1-yl)-4-(3,4,5-trimethoxybenzoyl)phenyl]-1,3-thiazol-2-yl]propanamide (PubChem CID 74963332) has the molecular formula C30H34N6O5S and a molecular weight of 590.71 g/mol. Its IUPAC name is 2-amino-3-cyclohexyl-N-[4-[3-(1,2,4-triazol-1-yl)-4-(3,4,5-trimethoxybenzoyl)phenyl]-1,3-thiazol-2-yl]propanamide.
| Compound Name | 2-amino-3-cyclohexyl-N-[4-[3-(1,2,4-triazol-1-yl)-4-(3,4,5-trimethoxybenzoyl)phenyl]-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 74963332 |
| Molecular Formula | C30H34N6O5S |
| Molecular Weight | 590.71 g/mol |
| Exact Mass | 590.23 |
| IUPAC Name | 2-amino-3-cyclohexyl-N-[4-[3-(1,2,4-triazol-1-yl)-4-(3,4,5-trimethoxybenzoyl)phenyl]-1,3-thiazol-2-yl]propanamide |
| SMILES | COc1cc(C(=O)c2ccc(-c3csc(NC(=O)C(N)CC4CCCCC4)n3)cc2-n2cncn2)cc(OC)c1OC |
| InChI | InChI=1S/C30H34N6O5S/c1-39-25-13-20(14-26(40-2)28(25)41-3)27(37)21-10-9-19(12-24(21)36-17-32-16-33-36)23-15-42-30(34-23)35-29(38)22(31)11-18-7-5-4-6-8-18/h9-10,12-18,22H,4-8,11,31H2,1-3H3,(H,34,35,38) |
| InChIKey | YJNLGGSRZLFSLV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.71 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |