C26H26N6O5S — CID 163444408
2-amino-3-methyl-N-[4-[3-(1,2,4-triazol-1-yl)-4-(3,4,5-trimethoxybenzoyl)phenyl]-1,3-thiazol-2-yl]but-2-enamide (PubChem CID 163444408) has the molecular formula C26H26N6O5S and a molecular weight of 534.60 g/mol. Its IUPAC name is 2-amino-3-methyl-N-[4-[3-(1,2,4-triazol-1-yl)-4-(3,4,5-trimethoxybenzoyl)phenyl]-1,3-thiazol-2-yl]but-2-enamide.
| Compound Name | 2-amino-3-methyl-N-[4-[3-(1,2,4-triazol-1-yl)-4-(3,4,5-trimethoxybenzoyl)phenyl]-1,3-thiazol-2-yl]but-2-enamide |
|---|---|
| PubChem CID | 163444408 |
| Molecular Formula | C26H26N6O5S |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | 2-amino-3-methyl-N-[4-[3-(1,2,4-triazol-1-yl)-4-(3,4,5-trimethoxybenzoyl)phenyl]-1,3-thiazol-2-yl]but-2-enamide |
| SMILES | COc1cc(C(=O)c2ccc(-c3csc(NC(=O)C(N)=C(C)C)n3)cc2-n2cncn2)cc(OC)c1OC |
| InChI | InChI=1S/C26H26N6O5S/c1-14(2)22(27)25(34)31-26-30-18(11-38-26)15-6-7-17(19(8-15)32-13-28-12-29-32)23(33)16-9-20(35-3)24(37-5)21(10-16)36-4/h6-13H,27H2,1-5H3,(H,30,31,34) |
| InChIKey | BBGWPYJTNQKGET-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|