C26H27N5O6S — CID 46937379
(2S)-3-methyl-2-[[4-[3-(1,2,4-triazol-1-yl)-4-(3,4,5-trimethoxybenzoyl)phenyl]-1,3-thiazol-2-yl]amino]butanoic acid (PubChem CID 46937379) has the molecular formula C26H27N5O6S and a molecular weight of 537.60 g/mol. Its IUPAC name is (2S)-3-methyl-2-[[4-[3-(1,2,4-triazol-1-yl)-4-(3,4,5-trimethoxybenzoyl)phenyl]-1,3-thiazol-2-yl]amino]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[[4-[3-(1,2,4-triazol-1-yl)-4-(3,4,5-trimethoxybenzoyl)phenyl]-1,3-thiazol-2-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 46937379 |
| Molecular Formula | C26H27N5O6S |
| Molecular Weight | 537.60 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | (2S)-3-methyl-2-[[4-[3-(1,2,4-triazol-1-yl)-4-(3,4,5-trimethoxybenzoyl)phenyl]-1,3-thiazol-2-yl]amino]butanoic acid |
| SMILES | COc1cc(C(=O)c2ccc(-c3csc(N[C@H](C(=O)O)C(C)C)n3)cc2-n2cncn2)cc(OC)c1OC |
| InChI | InChI=1S/C26H27N5O6S/c1-14(2)22(25(33)34)30-26-29-18(11-38-26)15-6-7-17(19(8-15)31-13-27-12-28-31)23(32)16-9-20(35-3)24(37-5)21(10-16)36-4/h6-14,22H,1-5H3,(H,29,30)(H,33,34)/t22-/m0/s1 |
| InChIKey | IKRQDGVMVDRBCC-QFIPXVFZSA-N |
| XLogP | 4.17 |
| TPSA | 137.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.60 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |