C36H37ClN8O4 — CID 75058860
N-[3-[8-(3-aminopropoxy)-2-(4-morpholin-4-ylanilino)quinazolin-6-yl]prop-2-enyl]-1-[(6-chloro-3-pyridinyl)methyl]-2-oxopyridine-3-carboxamide (PubChem CID 75058860) has the molecular formula C36H37ClN8O4 and a molecular weight of 681.20 g/mol. Its IUPAC name is N-[3-[8-(3-aminopropoxy)-2-(4-morpholin-4-ylanilino)quinazolin-6-yl]prop-2-enyl]-1-[(6-chloro-3-pyridinyl)methyl]-2-oxopyridine-3-carboxamide.
| Compound Name | N-[3-[8-(3-aminopropoxy)-2-(4-morpholin-4-ylanilino)quinazolin-6-yl]prop-2-enyl]-1-[(6-chloro-3-pyridinyl)methyl]-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 75058860 |
| Molecular Formula | C36H37ClN8O4 |
| Molecular Weight | 681.20 g/mol |
| Exact Mass | 680.26 |
| IUPAC Name | N-[3-[8-(3-aminopropoxy)-2-(4-morpholin-4-ylanilino)quinazolin-6-yl]prop-2-enyl]-1-[(6-chloro-3-pyridinyl)methyl]-2-oxopyridine-3-carboxamide |
| SMILES | NCCCOc1cc(C=CCNC(=O)c2cccn(Cc3ccc(Cl)nc3)c2=O)cc2cnc(Nc3ccc(N4CCOCC4)cc3)nc12 |
| InChI | InChI=1S/C36H37ClN8O4/c37-32-11-6-26(22-40-32)24-45-14-2-5-30(35(45)47)34(46)39-13-1-4-25-20-27-23-41-36(43-33(27)31(21-25)49-17-3-12-38)42-28-7-9-29(10-8-28)44-15-18-48-19-16-44/h1-2,4-11,14,20-23H,3,12-13,15-19,24,38H2,(H,39,46)(H,41,42,43) |
| InChIKey | PDLLTGRAYWASSE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 149.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.20 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|