C16H12O6S3 — CID 75089882
dimethyl 3,9-dioxo-6-sulfanylidene-5,7-dithiatetracyclo[9.2.1.02,10.04,8]tetradeca-4(8),12-diene-2,10-dicarboxylate (PubChem CID 75089882) has the molecular formula C16H12O6S3 and a molecular weight of 396.47 g/mol. Its IUPAC name is dimethyl 3,9-dioxo-6-sulfanylidene-5,7-dithiatetracyclo[9.2.1.02,10.04,8]tetradeca-4(8),12-diene-2,10-dicarboxylate.
| Compound Name | dimethyl 3,9-dioxo-6-sulfanylidene-5,7-dithiatetracyclo[9.2.1.02,10.04,8]tetradeca-4(8),12-diene-2,10-dicarboxylate |
|---|---|
| PubChem CID | 75089882 |
| Molecular Formula | C16H12O6S3 |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 395.98 |
| IUPAC Name | dimethyl 3,9-dioxo-6-sulfanylidene-5,7-dithiatetracyclo[9.2.1.02,10.04,8]tetradeca-4(8),12-diene-2,10-dicarboxylate |
| SMILES | COC(=O)C12C(=O)c3sc(=S)sc3C(=O)C1(C(=O)OC)C1C=CC2C1 |
| InChI | InChI=1S/C16H12O6S3/c1-21-12(19)15-6-3-4-7(5-6)16(15,13(20)22-2)11(18)9-8(10(15)17)24-14(23)25-9/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | QMPIMRWNJWKANE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|