C16H16N2O7S3 — CID 75095033
acetic acid;3-(1,1-dioxothiolan-3-yl)-5-[(2-nitrophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 75095033) has the molecular formula C16H16N2O7S3 and a molecular weight of 444.51 g/mol. Its IUPAC name is acetic acid;3-(1,1-dioxothiolan-3-yl)-5-[(2-nitrophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | acetic acid;3-(1,1-dioxothiolan-3-yl)-5-[(2-nitrophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 75095033 |
| Molecular Formula | C16H16N2O7S3 |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.01 |
| IUPAC Name | acetic acid;3-(1,1-dioxothiolan-3-yl)-5-[(2-nitrophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC(=O)O.O=C1C(=Cc2ccccc2[N+](=O)[O-])SC(=S)N1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H12N2O5S3.C2H4O2/c17-13-12(7-9-3-1-2-4-11(9)16(18)19)23-14(22)15(13)10-5-6-24(20,21)8-10;1-2(3)4/h1-4,7,10H,5-6,8H2;1H3,(H,3,4) |
| InChIKey | FMNLJYOKGIPDFP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 134.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|