C22H18ClN3O6 — CID 75110103
[[1-amino-2-(4'-chloro-2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)ethylidene]amino] cyclopropanecarboxylate (PubChem CID 75110103) has the molecular formula C22H18ClN3O6 and a molecular weight of 455.85 g/mol. Its IUPAC name is [[1-amino-2-(4'-chloro-2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)ethylidene]amino] cyclopropanecarboxylate.
| Compound Name | [[1-amino-2-(4'-chloro-2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)ethylidene]amino] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 75110103 |
| Molecular Formula | C22H18ClN3O6 |
| Molecular Weight | 455.85 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | [[1-amino-2-(4'-chloro-2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)ethylidene]amino] cyclopropanecarboxylate |
| SMILES | NC(CN1C(=O)C2(COc3cc4c(cc32)OCO4)c2c(Cl)cccc21)=NOC(=O)C1CC1 |
| InChI | InChI=1S/C22H18ClN3O6/c23-13-2-1-3-14-19(13)22(9-29-15-7-17-16(6-12(15)22)30-10-31-17)21(28)26(14)8-18(24)25-32-20(27)11-4-5-11/h1-3,6-7,11H,4-5,8-10H2,(H2,24,25) |
| InChIKey | OQDIVEMNAOEEBJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 112.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.85 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|