C26H21ClN2O5 — CID 66642460
2-chloro-N-[3-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)propyl]benzamide (PubChem CID 66642460) has the molecular formula C26H21ClN2O5 and a molecular weight of 476.92 g/mol. Its IUPAC name is 2-chloro-N-[3-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)propyl]benzamide.
| Compound Name | 2-chloro-N-[3-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)propyl]benzamide |
|---|---|
| PubChem CID | 66642460 |
| Molecular Formula | C26H21ClN2O5 |
| Molecular Weight | 476.92 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 2-chloro-N-[3-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)propyl]benzamide |
| SMILES | O=C(NCCCN1C(=O)C2(COc3cc4c(cc32)OCO4)c2ccccc21)c1ccccc1Cl |
| InChI | InChI=1S/C26H21ClN2O5/c27-19-8-3-1-6-16(19)24(30)28-10-5-11-29-20-9-4-2-7-17(20)26(25(29)31)14-32-21-13-23-22(12-18(21)26)33-15-34-23/h1-4,6-9,12-13H,5,10-11,14-15H2,(H,28,30) |
| InChIKey | SEIQKQWCQOEDPC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.92 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|