C26H24N2O6 — CID 66642553
2,5-dimethyl-N-[3-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)propyl]furan-3-carboxamide (PubChem CID 66642553) has the molecular formula C26H24N2O6 and a molecular weight of 460.49 g/mol. Its IUPAC name is 2,5-dimethyl-N-[3-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)propyl]furan-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-[3-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)propyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 66642553 |
| Molecular Formula | C26H24N2O6 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 2,5-dimethyl-N-[3-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)propyl]furan-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCN2C(=O)C3(COc4cc5c(cc43)OCO5)c3ccccc32)c(C)o1 |
| InChI | InChI=1S/C26H24N2O6/c1-15-10-17(16(2)34-15)24(29)27-8-5-9-28-20-7-4-3-6-18(20)26(25(28)30)13-31-21-12-23-22(11-19(21)26)32-14-33-23/h3-4,6-7,10-12H,5,8-9,13-14H2,1-2H3,(H,27,29) |
| InChIKey | VORAQRQIXCJDIC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 90.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|