C22H21N3O4 — CID 66642117
3-[3-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)propylamino]propanenitrile (PubChem CID 66642117) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is 3-[3-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)propylamino]propanenitrile.
| Compound Name | 3-[3-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)propylamino]propanenitrile |
|---|---|
| PubChem CID | 66642117 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 3-[3-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)propylamino]propanenitrile |
| SMILES | N#CCCNCCCN1C(=O)C2(COc3cc4c(cc32)OCO4)c2ccccc21 |
| InChI | InChI=1S/C22H21N3O4/c23-7-3-8-24-9-4-10-25-17-6-2-1-5-15(17)22(21(25)26)13-27-18-12-20-19(11-16(18)22)28-14-29-20/h1-2,5-6,11-12,24H,3-4,8-10,13-14H2 |
| InChIKey | XVURKFKMGMJWPZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|