C23H26N2O5 — CID 66642059
1'-[3-(2-ethoxyethylamino)propyl]spiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one (PubChem CID 66642059) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is 1'-[3-(2-ethoxyethylamino)propyl]spiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one.
| Compound Name | 1'-[3-(2-ethoxyethylamino)propyl]spiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one |
|---|---|
| PubChem CID | 66642059 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 1'-[3-(2-ethoxyethylamino)propyl]spiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one |
| SMILES | CCOCCNCCCN1C(=O)C2(COc3cc4c(cc32)OCO4)c2ccccc21 |
| InChI | InChI=1S/C23H26N2O5/c1-2-27-11-9-24-8-5-10-25-18-7-4-3-6-16(18)23(22(25)26)14-28-19-13-21-20(12-17(19)23)29-15-30-21/h3-4,6-7,12-13,24H,2,5,8-11,14-15H2,1H3 |
| InChIKey | GKPLEGSELZQOTP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|