C27H32N2O4 — CID 66642082
1'-[3-[[(1S)-1-cyclohexylethyl]amino]propyl]spiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one (PubChem CID 66642082) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is 1'-[3-[[(1S)-1-cyclohexylethyl]amino]propyl]spiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one.
| Compound Name | 1'-[3-[[(1S)-1-cyclohexylethyl]amino]propyl]spiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one |
|---|---|
| PubChem CID | 66642082 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 1'-[3-[[(1S)-1-cyclohexylethyl]amino]propyl]spiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one |
| SMILES | C[C@H](NCCCN1C(=O)C2(COc3cc4c(cc32)OCO4)c2ccccc21)C1CCCCC1 |
| InChI | InChI=1S/C27H32N2O4/c1-18(19-8-3-2-4-9-19)28-12-7-13-29-22-11-6-5-10-20(22)27(26(29)30)16-31-23-15-25-24(14-21(23)27)32-17-33-25/h5-6,10-11,14-15,18-19,28H,2-4,7-9,12-13,16-17H2,1H3/t18-,27?/m0/s1 |
| InChIKey | MQYFFEWXYLIVQO-HSYKDVHTSA-N |
| XLogP | 4.39 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|