C30H30N2O5 — CID 11999892
4-tert-butyl-N-[3-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)propyl]benzamide (PubChem CID 11999892) has the molecular formula C30H30N2O5 and a molecular weight of 498.58 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)propyl]benzamide.
| Compound Name | 4-tert-butyl-N-[3-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)propyl]benzamide |
|---|---|
| PubChem CID | 11999892 |
| Molecular Formula | C30H30N2O5 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | 4-tert-butyl-N-[3-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)propyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NCCCN2C(=O)C3(COc4cc5c(cc43)OCO5)c3ccccc32)cc1 |
| InChI | InChI=1S/C30H30N2O5/c1-29(2,3)20-11-9-19(10-12-20)27(33)31-13-6-14-32-23-8-5-4-7-21(23)30(28(32)34)17-35-24-16-26-25(15-22(24)30)36-18-37-26/h4-5,7-12,15-16H,6,13-14,17-18H2,1-3H3,(H,31,33) |
| InChIKey | OOECYYNHQPHKAP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|