C19H15BrFN4O3+ — CID 75118631
1-[[3-(3-bromo-4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-ethyl-4aH-quinazolin-1-ium-2,4-dione (PubChem CID 75118631) has the molecular formula C19H15BrFN4O3+ and a molecular weight of 446.26 g/mol. Its IUPAC name is 1-[[3-(3-bromo-4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-ethyl-4aH-quinazolin-1-ium-2,4-dione.
| Compound Name | 1-[[3-(3-bromo-4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-ethyl-4aH-quinazolin-1-ium-2,4-dione |
|---|---|
| PubChem CID | 75118631 |
| Molecular Formula | C19H15BrFN4O3+ |
| Molecular Weight | 446.26 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | 1-[[3-(3-bromo-4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-ethyl-4aH-quinazolin-1-ium-2,4-dione |
| SMILES | CCN1C(=O)C2C=CC=CC2=[N+](Cc2nc(-c3ccc(F)c(Br)c3)no2)C1=O |
| InChI | InChI=1S/C19H15BrFN4O3/c1-2-24-18(26)12-5-3-4-6-15(12)25(19(24)27)10-16-22-17(23-28-16)11-7-8-14(21)13(20)9-11/h3-9,12H,2,10H2,1H3/q+1 |
| InChIKey | CPVRGAGGNNKVGY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 79.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.26 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|