C22H23N4O3+ — CID 74610217
3-butan-2-yl-1-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-4aH-quinazolin-1-ium-2,4-dione (PubChem CID 74610217) has the molecular formula C22H23N4O3+ and a molecular weight of 391.45 g/mol. Its IUPAC name is 3-butan-2-yl-1-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-4aH-quinazolin-1-ium-2,4-dione.
| Compound Name | 3-butan-2-yl-1-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-4aH-quinazolin-1-ium-2,4-dione |
|---|---|
| PubChem CID | 74610217 |
| Molecular Formula | C22H23N4O3+ |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 3-butan-2-yl-1-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-4aH-quinazolin-1-ium-2,4-dione |
| SMILES | CCC(C)N1C(=O)C2C=CC=CC2=[N+](Cc2nc(-c3ccc(C)cc3)no2)C1=O |
| InChI | InChI=1S/C22H23N4O3/c1-4-15(3)26-21(27)17-7-5-6-8-18(17)25(22(26)28)13-19-23-20(24-29-19)16-11-9-14(2)10-12-16/h5-12,15,17H,4,13H2,1-3H3/q+1 |
| InChIKey | VSXLQVCMXNGLNH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 79.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|