C23H23N4O4+ — CID 75118638
1-[[3-(4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-prop-2-enyl-4aH-quinazolin-1-ium-2,4-dione (PubChem CID 75118638) has the molecular formula C23H23N4O4+ and a molecular weight of 419.46 g/mol. Its IUPAC name is 1-[[3-(4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-prop-2-enyl-4aH-quinazolin-1-ium-2,4-dione.
| Compound Name | 1-[[3-(4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-prop-2-enyl-4aH-quinazolin-1-ium-2,4-dione |
|---|---|
| PubChem CID | 75118638 |
| Molecular Formula | C23H23N4O4+ |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 1-[[3-(4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-prop-2-enyl-4aH-quinazolin-1-ium-2,4-dione |
| SMILES | C=CCN1C(=O)C2C=CC=CC2=[N+](Cc2nc(-c3ccc(OC(C)C)cc3)no2)C1=O |
| InChI | InChI=1S/C23H23N4O4/c1-4-13-26-22(28)18-7-5-6-8-19(18)27(23(26)29)14-20-24-21(25-31-20)16-9-11-17(12-10-16)30-15(2)3/h4-12,15,18H,1,13-14H2,2-3H3/q+1 |
| InChIKey | AKKFJOAIFJSHLZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 88.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|