C23H24ClN5O2 — CID 75118726
N-[(4-chlorophenyl)methyl]-5-(4-phenylmethoxyanilino)triazolidine-4-carboxamide (PubChem CID 75118726) has the molecular formula C23H24ClN5O2 and a molecular weight of 437.93 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-5-(4-phenylmethoxyanilino)triazolidine-4-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-5-(4-phenylmethoxyanilino)triazolidine-4-carboxamide |
|---|---|
| PubChem CID | 75118726 |
| Molecular Formula | C23H24ClN5O2 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-5-(4-phenylmethoxyanilino)triazolidine-4-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)C1NNNC1Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H24ClN5O2/c24-18-8-6-16(7-9-18)14-25-23(30)21-22(28-29-27-21)26-19-10-12-20(13-11-19)31-15-17-4-2-1-3-5-17/h1-13,21-22,26-29H,14-15H2,(H,25,30) |
| InChIKey | XSVYVZZTPPDRNO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 86.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|