C24H25N5O4 — CID 75271855
N-(1,3-benzodioxol-5-ylmethyl)-5-(4-phenylmethoxyanilino)triazolidine-4-carboxamide (PubChem CID 75271855) has the molecular formula C24H25N5O4 and a molecular weight of 447.50 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-5-(4-phenylmethoxyanilino)triazolidine-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-5-(4-phenylmethoxyanilino)triazolidine-4-carboxamide |
|---|---|
| PubChem CID | 75271855 |
| Molecular Formula | C24H25N5O4 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-5-(4-phenylmethoxyanilino)triazolidine-4-carboxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)C1NNNC1Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H25N5O4/c30-24(25-13-17-6-11-20-21(12-17)33-15-32-20)22-23(28-29-27-22)26-18-7-9-19(10-8-18)31-14-16-4-2-1-3-5-16/h1-12,22-23,26-29H,13-15H2,(H,25,30) |
| InChIKey | JHVUOGSNKKUHNE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|