C18H18ClF2N5O4 — CID 78151469
5-(1,3-benzodioxol-5-ylmethylamino)-N-[4-[chloro(difluoro)methoxy]phenyl]triazolidine-4-carboxamide (PubChem CID 78151469) has the molecular formula C18H18ClF2N5O4 and a molecular weight of 441.82 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethylamino)-N-[4-[chloro(difluoro)methoxy]phenyl]triazolidine-4-carboxamide.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethylamino)-N-[4-[chloro(difluoro)methoxy]phenyl]triazolidine-4-carboxamide |
|---|---|
| PubChem CID | 78151469 |
| Molecular Formula | C18H18ClF2N5O4 |
| Molecular Weight | 441.82 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethylamino)-N-[4-[chloro(difluoro)methoxy]phenyl]triazolidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)Cl)cc1)C1NNNC1NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H18ClF2N5O4/c19-18(20,21)30-12-4-2-11(3-5-12)23-17(27)15-16(25-26-24-15)22-8-10-1-6-13-14(7-10)29-9-28-13/h1-7,15-16,22,24-26H,8-9H2,(H,23,27) |
| InChIKey | PJJFZPIIXUHGOQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.82 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|