C12H13ClN4O5 — CID 78373314
N-(1,3-benzodioxol-5-ylmethyl)-4-chloro-5-nitropyrazolidine-3-carboxamide (PubChem CID 78373314) has the molecular formula C12H13ClN4O5 and a molecular weight of 328.71 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-4-chloro-5-nitropyrazolidine-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-4-chloro-5-nitropyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 78373314 |
| Molecular Formula | C12H13ClN4O5 |
| Molecular Weight | 328.71 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-4-chloro-5-nitropyrazolidine-3-carboxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)C1NNC([N+](=O)[O-])C1Cl |
| InChI | InChI=1S/C12H13ClN4O5/c13-9-10(15-16-11(9)17(19)20)12(18)14-4-6-1-2-7-8(3-6)22-5-21-7/h1-3,9-11,15-16H,4-5H2,(H,14,18) |
| InChIKey | SNSUJWLXQSHNCO-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.71 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|