About 6-bromopiperazin-2-one
6-bromopiperazin-2-one (PubChem CID 75132381) has the molecular formula C4H7BrN2O
and a molecular weight of 179.02 g/mol. Its IUPAC name is 6-bromopiperazin-2-one.
Molecular Properties
| Compound Name | 6-bromopiperazin-2-one |
| PubChem CID | 75132381 |
| Molecular Formula | C4H7BrN2O |
| Molecular Weight | 179.02 g/mol |
| Exact Mass | 177.97 |
| IUPAC Name | 6-bromopiperazin-2-one |
| SMILES | O=C1CNCC(Br)N1 |
| InChI | InChI=1S/C4H7BrN2O/c5-3-1-6-2-4(8)7-3/h3,6H,1-2H2,(H,7,8) |
| InChIKey | AWOQGXNEQKZKRP-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.02 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 6-bromopiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromopiperazin-2-one?
The IUPAC name of 6-bromopiperazin-2-one (CID 75132381) is 6-bromopiperazin-2-one.
What is the SMILES notation for 6-bromopiperazin-2-one?
The canonical SMILES for 6-bromopiperazin-2-one is O=C1CNCC(Br)N1.
What is the InChIKey of 6-bromopiperazin-2-one?
The InChIKey is AWOQGXNEQKZKRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7BrN2O/c5-3-1-6-2-4(8)7-3/h3,6H,1-2H2,(H,7,8).
What are the key properties of 6-bromopiperazin-2-one?
6-bromopiperazin-2-one has a molecular weight of 179.02 g/mol, XLogP of -0.57, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromopiperazin-2-one is sourced from PubChem (CID 75132381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).