About 2-[2-(octylamino)propyl]oxane-3,4,5-triol
2-[2-(octylamino)propyl]oxane-3,4,5-triol (PubChem CID 75150516) has the molecular formula C16H33NO4
and a molecular weight of 303.44 g/mol. Its IUPAC name is 2-[2-(octylamino)propyl]oxane-3,4,5-triol.
Molecular Properties
| Compound Name | 2-[2-(octylamino)propyl]oxane-3,4,5-triol |
| PubChem CID | 75150516 |
| Molecular Formula | C16H33NO4 |
| Molecular Weight | 303.44 g/mol |
| Exact Mass | 303.24 |
| IUPAC Name | 2-[2-(octylamino)propyl]oxane-3,4,5-triol |
| SMILES | CCCCCCCCNC(C)CC1OCC(O)C(O)C1O |
| InChI | InChI=1S/C16H33NO4/c1-3-4-5-6-7-8-9-17-12(2)10-14-16(20)15(19)13(18)11-21-14/h12-20H,3-11H2,1-2H3 |
| InChIKey | WOTNJJRUYNVFBZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.44 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(octylamino)propyl]oxane-3,4,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(octylamino)propyl]oxane-3,4,5-triol?
The IUPAC name of 2-[2-(octylamino)propyl]oxane-3,4,5-triol (CID 75150516) is 2-[2-(octylamino)propyl]oxane-3,4,5-triol.
What is the SMILES notation for 2-[2-(octylamino)propyl]oxane-3,4,5-triol?
The canonical SMILES for 2-[2-(octylamino)propyl]oxane-3,4,5-triol is CCCCCCCCNC(C)CC1OCC(O)C(O)C1O.
What is the InChIKey of 2-[2-(octylamino)propyl]oxane-3,4,5-triol?
The InChIKey is WOTNJJRUYNVFBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33NO4/c1-3-4-5-6-7-8-9-17-12(2)10-14-16(20)15(19)13(18)11-21-14/h12-20H,3-11H2,1-2H3.
What are the key properties of 2-[2-(octylamino)propyl]oxane-3,4,5-triol?
2-[2-(octylamino)propyl]oxane-3,4,5-triol has a molecular weight of 303.44 g/mol, XLogP of 1.20, 10 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(octylamino)propyl]oxane-3,4,5-triol is sourced from PubChem (CID 75150516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).