About 2-(2-hydroxy-2-octoxyethyl)oxolane-3,4-diol
2-(2-hydroxy-2-octoxyethyl)oxolane-3,4-diol (PubChem CID 70976729) has the molecular formula C14H28O5
and a molecular weight of 276.37 g/mol. Its IUPAC name is 2-(2-hydroxy-2-octoxyethyl)oxolane-3,4-diol.
Molecular Properties
| Compound Name | 2-(2-hydroxy-2-octoxyethyl)oxolane-3,4-diol |
| PubChem CID | 70976729 |
| Molecular Formula | C14H28O5 |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | 2-(2-hydroxy-2-octoxyethyl)oxolane-3,4-diol |
| SMILES | CCCCCCCCOC(O)CC1OCC(O)C1O |
| InChI | InChI=1S/C14H28O5/c1-2-3-4-5-6-7-8-18-13(16)9-12-14(17)11(15)10-19-12/h11-17H,2-10H2,1H3 |
| InChIKey | UAJODHNZMLRXJK-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydroxy-2-octoxyethyl)oxolane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxy-2-octoxyethyl)oxolane-3,4-diol?
The IUPAC name of 2-(2-hydroxy-2-octoxyethyl)oxolane-3,4-diol (CID 70976729) is 2-(2-hydroxy-2-octoxyethyl)oxolane-3,4-diol.
What is the SMILES notation for 2-(2-hydroxy-2-octoxyethyl)oxolane-3,4-diol?
The canonical SMILES for 2-(2-hydroxy-2-octoxyethyl)oxolane-3,4-diol is CCCCCCCCOC(O)CC1OCC(O)C1O.
What is the InChIKey of 2-(2-hydroxy-2-octoxyethyl)oxolane-3,4-diol?
The InChIKey is UAJODHNZMLRXJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O5/c1-2-3-4-5-6-7-8-18-13(16)9-12-14(17)11(15)10-19-12/h11-17H,2-10H2,1H3.
What are the key properties of 2-(2-hydroxy-2-octoxyethyl)oxolane-3,4-diol?
2-(2-hydroxy-2-octoxyethyl)oxolane-3,4-diol has a molecular weight of 276.37 g/mol, XLogP of 1.19, 10 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxy-2-octoxyethyl)oxolane-3,4-diol is sourced from PubChem (CID 70976729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).