C22H46N2O11 — CID 159238501
3-aminopropan-1-ol;(2S,3R,4S,5R)-2-[2-(3-hydroxypropylamino)propyl]oxane-3,4,5-triol;1-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]propan-2-one (PubChem CID 159238501) has the molecular formula C22H46N2O11 and a molecular weight of 514.61 g/mol. Its IUPAC name is 3-aminopropan-1-ol;(2S,3R,4S,5R)-2-[2-(3-hydroxypropylamino)propyl]oxane-3,4,5-triol;1-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]propan-2-one.
| Compound Name | 3-aminopropan-1-ol;(2S,3R,4S,5R)-2-[2-(3-hydroxypropylamino)propyl]oxane-3,4,5-triol;1-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 159238501 |
| Molecular Formula | C22H46N2O11 |
| Molecular Weight | 514.61 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | 3-aminopropan-1-ol;(2S,3R,4S,5R)-2-[2-(3-hydroxypropylamino)propyl]oxane-3,4,5-triol;1-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]propan-2-one |
| SMILES | CC(=O)C[C@@H]1OCC(O)[C@H](O)[C@H]1O.CC(C[C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O)NCCCO.NCCCO |
| InChI | InChI=1S/C11H23NO5.C8H14O5.C3H9NO/c1-7(12-3-2-4-13)5-9-11(16)10(15)8(14)6-17-9;1-4(9)2-6-8(12)7(11)5(10)3-13-6;4-2-1-3-5/h7-16H,2-6H2,1H3;5-8,10-12H,2-3H2,1H3;5H,1-4H2/t7?,8-,9+,10+,11+;5?,6-,7-,8-;/m10./s1 |
| InChIKey | KTUCISBDZAYVLP-LEQSNMSNSA-N |
| XLogP | -4.01 |
| TPSA | 235.42 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.61 |
| LogP ≤ 5 | -4.01 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|