C12H22O6 — CID 175493729
oxolane;1-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]propan-2-one (PubChem CID 175493729) has the molecular formula C12H22O6 and a molecular weight of 262.30 g/mol. Its IUPAC name is oxolane;1-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]propan-2-one.
| Compound Name | oxolane;1-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 175493729 |
| Molecular Formula | C12H22O6 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | oxolane;1-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]propan-2-one |
| SMILES | C1CCOC1.CC(=O)C[C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H14O5.C4H8O/c1-4(9)2-6-8(12)7(11)5(10)3-13-6;1-2-4-5-3-1/h5-8,10-12H,2-3H2,1H3;1-4H2/t5-,6+,7+,8+;/m1./s1 |
| InChIKey | VTLZUUYZDUPZJC-REIUNREZSA-N |
| XLogP | -0.76 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |