C12H22O6 — CID 58633646
ethyl 3-methyl-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]butanoate (PubChem CID 58633646) has the molecular formula C12H22O6 and a molecular weight of 262.30 g/mol. Its IUPAC name is ethyl 3-methyl-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]butanoate.
| Compound Name | ethyl 3-methyl-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]butanoate |
|---|---|
| PubChem CID | 58633646 |
| Molecular Formula | C12H22O6 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | ethyl 3-methyl-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]butanoate |
| SMILES | CCOC(=O)CC(C)C[C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H22O6/c1-3-17-10(14)5-7(2)4-9-12(16)11(15)8(13)6-18-9/h7-9,11-13,15-16H,3-6H2,1-2H3/t7?,8-,9+,11+,12+/m1/s1 |
| InChIKey | PGEHJRKSFPKHDY-LQDPLHTFSA-N |
| XLogP | -0.55 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |