C12H9N5O3 — CID 751552
8-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)oxy]quinoline (PubChem CID 751552) has the molecular formula C12H9N5O3 and a molecular weight of 271.24 g/mol. Its IUPAC name is 8-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)oxy]quinoline.
| Compound Name | 8-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)oxy]quinoline |
|---|---|
| PubChem CID | 751552 |
| Molecular Formula | C12H9N5O3 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 8-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)oxy]quinoline |
| SMILES | Cn1nc([N+](=O)[O-])nc1Oc1cccc2cccnc12 |
| InChI | InChI=1S/C12H9N5O3/c1-16-12(14-11(15-16)17(18)19)20-9-6-2-4-8-5-3-7-13-10(8)9/h2-7H,1H3 |
| InChIKey | BBKACMQEKPZARV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|