C12H17N3S — CID 751669
1-benzyl-5-ethyl-1,3,5-triazinane-2-thione (PubChem CID 751669) has the molecular formula C12H17N3S and a molecular weight of 235.36 g/mol. Its IUPAC name is 1-benzyl-5-ethyl-1,3,5-triazinane-2-thione.
| Compound Name | 1-benzyl-5-ethyl-1,3,5-triazinane-2-thione |
|---|---|
| PubChem CID | 751669 |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 1-benzyl-5-ethyl-1,3,5-triazinane-2-thione |
| SMILES | CCN1CNC(=S)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C12H17N3S/c1-2-14-9-13-12(16)15(10-14)8-11-6-4-3-5-7-11/h3-7H,2,8-10H2,1H3,(H,13,16) |
| InChIKey | CEOWFRFECJRZCP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|