C27H32O9 — CID 75220890
(4,9,11,14-tetrahydroxy-10,13,16,16-tetramethyl-18-oxo-6,17-dioxapentacyclo[9.4.3.01,12.03,10.04,7]octadec-12-en-2-yl) benzoate (PubChem CID 75220890) has the molecular formula C27H32O9 and a molecular weight of 500.54 g/mol. Its IUPAC name is (4,9,11,14-tetrahydroxy-10,13,16,16-tetramethyl-18-oxo-6,17-dioxapentacyclo[9.4.3.01,12.03,10.04,7]octadec-12-en-2-yl) benzoate.
| Compound Name | (4,9,11,14-tetrahydroxy-10,13,16,16-tetramethyl-18-oxo-6,17-dioxapentacyclo[9.4.3.01,12.03,10.04,7]octadec-12-en-2-yl) benzoate |
|---|---|
| PubChem CID | 75220890 |
| Molecular Formula | C27H32O9 |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | (4,9,11,14-tetrahydroxy-10,13,16,16-tetramethyl-18-oxo-6,17-dioxapentacyclo[9.4.3.01,12.03,10.04,7]octadec-12-en-2-yl) benzoate |
| SMILES | CC1=C2C3(O)C(=O)OC(C)(C)C2(CC1O)C(OC(=O)c1ccccc1)C1C2(O)COC2CC(O)C13C |
| InChI | InChI=1S/C27H32O9/c1-13-15(28)11-25-18(13)27(33,22(31)36-23(25,2)3)24(4)16(29)10-17-26(32,12-34-17)19(24)20(25)35-21(30)14-8-6-5-7-9-14/h5-9,15-17,19-20,28-29,32-33H,10-12H2,1-4H3 |
| InChIKey | BRXGDKXKUBKWTF-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|