C27H34O9 — CID 73323574
[4,5,7,9-tetrahydroxy-4-(hydroxymethyl)-8,11,14,14-tetramethyl-16-oxo-15-oxatetracyclo[7.4.3.01,10.03,8]hexadec-10-en-2-yl] benzoate (PubChem CID 73323574) has the molecular formula C27H34O9 and a molecular weight of 502.56 g/mol. Its IUPAC name is [4,5,7,9-tetrahydroxy-4-(hydroxymethyl)-8,11,14,14-tetramethyl-16-oxo-15-oxatetracyclo[7.4.3.01,10.03,8]hexadec-10-en-2-yl] benzoate.
| Compound Name | [4,5,7,9-tetrahydroxy-4-(hydroxymethyl)-8,11,14,14-tetramethyl-16-oxo-15-oxatetracyclo[7.4.3.01,10.03,8]hexadec-10-en-2-yl] benzoate |
|---|---|
| PubChem CID | 73323574 |
| Molecular Formula | C27H34O9 |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | [4,5,7,9-tetrahydroxy-4-(hydroxymethyl)-8,11,14,14-tetramethyl-16-oxo-15-oxatetracyclo[7.4.3.01,10.03,8]hexadec-10-en-2-yl] benzoate |
| SMILES | CC1=C2C3(O)C(=O)OC(C)(C)C2(CC1)C(OC(=O)c1ccccc1)C1C(O)(CO)C(O)CC(O)C13C |
| InChI | InChI=1S/C27H34O9/c1-14-10-11-25-18(14)27(34,22(32)36-23(25,2)3)24(4)16(29)12-17(30)26(33,13-28)19(24)20(25)35-21(31)15-8-6-5-7-9-15/h5-9,16-17,19-20,28-30,33-34H,10-13H2,1-4H3 |
| InChIKey | ZRNIFDIEKWXFMO-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|