C29H36O11 — CID 163098868
[14-acetyloxy-5,11,13,16-tetrahydroxy-10-(2-hydroxypropan-2-yl)-7-methyl-4-oxo-3-oxatetracyclo[10.4.0.01,5.06,10]hexadec-6-en-13-yl]methyl benzoate (PubChem CID 163098868) has the molecular formula C29H36O11 and a molecular weight of 560.60 g/mol. Its IUPAC name is [14-acetyloxy-5,11,13,16-tetrahydroxy-10-(2-hydroxypropan-2-yl)-7-methyl-4-oxo-3-oxatetracyclo[10.4.0.01,5.06,10]hexadec-6-en-13-yl]methyl benzoate.
| Compound Name | [14-acetyloxy-5,11,13,16-tetrahydroxy-10-(2-hydroxypropan-2-yl)-7-methyl-4-oxo-3-oxatetracyclo[10.4.0.01,5.06,10]hexadec-6-en-13-yl]methyl benzoate |
|---|---|
| PubChem CID | 163098868 |
| Molecular Formula | C29H36O11 |
| Molecular Weight | 560.60 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | [14-acetyloxy-5,11,13,16-tetrahydroxy-10-(2-hydroxypropan-2-yl)-7-methyl-4-oxo-3-oxatetracyclo[10.4.0.01,5.06,10]hexadec-6-en-13-yl]methyl benzoate |
| SMILES | CC(=O)OC1CC(O)C23COC(=O)C2(O)C2=C(C)CCC2(C(C)(C)O)C(O)C3C1(O)COC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H36O11/c1-15-10-11-26(25(3,4)35)20(15)29(37)24(34)39-13-27(29)18(31)12-19(40-16(2)30)28(36,21(27)22(26)32)14-38-23(33)17-8-6-5-7-9-17/h5-9,18-19,21-22,31-32,35-37H,10-14H2,1-4H3 |
| InChIKey | RLVOMMLWMFHIRS-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 180.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.60 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|