C35H39FN4O3 — CID 75241813
5-[4-[2-amino-4-[3-[4-fluoro-1-(3-methoxypropyl)indol-2-yl]piperidin-1-yl]-4-oxobutyl]phenyl]-1,3-dihydroindol-2-one (PubChem CID 75241813) has the molecular formula C35H39FN4O3 and a molecular weight of 582.72 g/mol. Its IUPAC name is 5-[4-[2-amino-4-[3-[4-fluoro-1-(3-methoxypropyl)indol-2-yl]piperidin-1-yl]-4-oxobutyl]phenyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[4-[2-amino-4-[3-[4-fluoro-1-(3-methoxypropyl)indol-2-yl]piperidin-1-yl]-4-oxobutyl]phenyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 75241813 |
| Molecular Formula | C35H39FN4O3 |
| Molecular Weight | 582.72 g/mol |
| Exact Mass | 582.30 |
| IUPAC Name | 5-[4-[2-amino-4-[3-[4-fluoro-1-(3-methoxypropyl)indol-2-yl]piperidin-1-yl]-4-oxobutyl]phenyl]-1,3-dihydroindol-2-one |
| SMILES | COCCCn1c(C2CCCN(C(=O)CC(N)Cc3ccc(-c4ccc5c(c4)CC(=O)N5)cc3)C2)cc2c(F)cccc21 |
| InChI | InChI=1S/C35H39FN4O3/c1-43-16-4-15-40-32-7-2-6-30(36)29(32)21-33(40)26-5-3-14-39(22-26)35(42)20-28(37)17-23-8-10-24(11-9-23)25-12-13-31-27(18-25)19-34(41)38-31/h2,6-13,18,21,26,28H,3-5,14-17,19-20,22,37H2,1H3,(H,38,41) |
| InChIKey | UCHCWJWWMBKFSB-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.72 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|