C32H38FN5O3 — CID 75242178
3-amino-1-[3-[7-fluoro-1-(3-methoxypropyl)indol-2-yl]piperidin-1-yl]-4-[4-(2-methoxypyrimidin-5-yl)phenyl]butan-1-one (PubChem CID 75242178) has the molecular formula C32H38FN5O3 and a molecular weight of 559.69 g/mol. Its IUPAC name is 3-amino-1-[3-[7-fluoro-1-(3-methoxypropyl)indol-2-yl]piperidin-1-yl]-4-[4-(2-methoxypyrimidin-5-yl)phenyl]butan-1-one.
| Compound Name | 3-amino-1-[3-[7-fluoro-1-(3-methoxypropyl)indol-2-yl]piperidin-1-yl]-4-[4-(2-methoxypyrimidin-5-yl)phenyl]butan-1-one |
|---|---|
| PubChem CID | 75242178 |
| Molecular Formula | C32H38FN5O3 |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 559.30 |
| IUPAC Name | 3-amino-1-[3-[7-fluoro-1-(3-methoxypropyl)indol-2-yl]piperidin-1-yl]-4-[4-(2-methoxypyrimidin-5-yl)phenyl]butan-1-one |
| SMILES | COCCCn1c(C2CCCN(C(=O)CC(N)Cc3ccc(-c4cnc(OC)nc4)cc3)C2)cc2cccc(F)c21 |
| InChI | InChI=1S/C32H38FN5O3/c1-40-15-5-14-38-29(17-24-6-3-8-28(33)31(24)38)25-7-4-13-37(21-25)30(39)18-27(34)16-22-9-11-23(12-10-22)26-19-35-32(41-2)36-20-26/h3,6,8-12,17,19-20,25,27H,4-5,7,13-16,18,21,34H2,1-2H3 |
| InChIKey | HHMIGJGNQCWWKT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|