C31H37FN6O2 — CID 46932254
(3R)-3-amino-4-[4-(2-aminopyrimidin-5-yl)phenyl]-1-[3-[6-fluoro-1-(3-methoxypropyl)indol-2-yl]piperidin-1-yl]butan-1-one (PubChem CID 46932254) has the molecular formula C31H37FN6O2 and a molecular weight of 544.68 g/mol. Its IUPAC name is (3R)-3-amino-4-[4-(2-aminopyrimidin-5-yl)phenyl]-1-[3-[6-fluoro-1-(3-methoxypropyl)indol-2-yl]piperidin-1-yl]butan-1-one.
| Compound Name | (3R)-3-amino-4-[4-(2-aminopyrimidin-5-yl)phenyl]-1-[3-[6-fluoro-1-(3-methoxypropyl)indol-2-yl]piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 46932254 |
| Molecular Formula | C31H37FN6O2 |
| Molecular Weight | 544.68 g/mol |
| Exact Mass | 544.30 |
| IUPAC Name | (3R)-3-amino-4-[4-(2-aminopyrimidin-5-yl)phenyl]-1-[3-[6-fluoro-1-(3-methoxypropyl)indol-2-yl]piperidin-1-yl]butan-1-one |
| SMILES | COCCCn1c(C2CCCN(C(=O)C[C@H](N)Cc3ccc(-c4cnc(N)nc4)cc3)C2)cc2ccc(F)cc21 |
| InChI | InChI=1S/C31H37FN6O2/c1-40-13-3-12-38-28(15-23-9-10-26(32)16-29(23)38)24-4-2-11-37(20-24)30(39)17-27(33)14-21-5-7-22(8-6-21)25-18-35-31(34)36-19-25/h5-10,15-16,18-19,24,27H,2-4,11-14,17,20,33H2,1H3,(H2,34,35,36)/t24?,27-/m1/s1 |
| InChIKey | CUUYWGYKGKZAQH-LFHRXCRSSA-N |
| XLogP | 4.52 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.68 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|