C35H41FN2O3 — CID 90711554
4-[4-[4-[3-[6-fluoro-1-(3-methoxypropyl)indol-2-yl]piperidin-1-yl]-4-oxobutyl]phenyl]cycloocta-2,4-dien-1-one (PubChem CID 90711554) has the molecular formula C35H41FN2O3 and a molecular weight of 556.72 g/mol. Its IUPAC name is 4-[4-[4-[3-[6-fluoro-1-(3-methoxypropyl)indol-2-yl]piperidin-1-yl]-4-oxobutyl]phenyl]cycloocta-2,4-dien-1-one.
| Compound Name | 4-[4-[4-[3-[6-fluoro-1-(3-methoxypropyl)indol-2-yl]piperidin-1-yl]-4-oxobutyl]phenyl]cycloocta-2,4-dien-1-one |
|---|---|
| PubChem CID | 90711554 |
| Molecular Formula | C35H41FN2O3 |
| Molecular Weight | 556.72 g/mol |
| Exact Mass | 556.31 |
| IUPAC Name | 4-[4-[4-[3-[6-fluoro-1-(3-methoxypropyl)indol-2-yl]piperidin-1-yl]-4-oxobutyl]phenyl]cycloocta-2,4-dien-1-one |
| SMILES | COCCCn1c(C2CCCN(C(=O)CCCc3ccc(C4=CCCCC(=O)C=C4)cc3)C2)cc2ccc(F)cc21 |
| InChI | InChI=1S/C35H41FN2O3/c1-41-22-6-21-38-33(23-29-16-18-31(36)24-34(29)38)30-9-5-20-37(25-30)35(40)11-4-7-26-12-14-28(15-13-26)27-8-2-3-10-32(39)19-17-27/h8,12-19,23-24,30H,2-7,9-11,20-22,25H2,1H3 |
| InChIKey | JLYSKWCEQVYGAX-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.72 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|