C13H21N3O2 — CID 75247392
8-amino-5-propan-2-yl-1,6-diazacyclododeca-3,9-diene-2,7-dione (PubChem CID 75247392) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 8-amino-5-propan-2-yl-1,6-diazacyclododeca-3,9-diene-2,7-dione.
| Compound Name | 8-amino-5-propan-2-yl-1,6-diazacyclododeca-3,9-diene-2,7-dione |
|---|---|
| PubChem CID | 75247392 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 8-amino-5-propan-2-yl-1,6-diazacyclododeca-3,9-diene-2,7-dione |
| SMILES | CC(C)C1C=CC(=O)NCCC=CC(N)C(=O)N1 |
| InChI | InChI=1S/C13H21N3O2/c1-9(2)11-6-7-12(17)15-8-4-3-5-10(14)13(18)16-11/h3,5-7,9-11H,4,8,14H2,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | MRKWZMWWFWYUDW-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|