C20H27FN4O — CID 75259366
2-[[3-(4-fluorophenyl)pyrazolidin-4-yl]methyl-(pyridin-4-ylmethyl)amino]butan-1-ol (PubChem CID 75259366) has the molecular formula C20H27FN4O and a molecular weight of 358.46 g/mol. Its IUPAC name is 2-[[3-(4-fluorophenyl)pyrazolidin-4-yl]methyl-(pyridin-4-ylmethyl)amino]butan-1-ol.
| Compound Name | 2-[[3-(4-fluorophenyl)pyrazolidin-4-yl]methyl-(pyridin-4-ylmethyl)amino]butan-1-ol |
|---|---|
| PubChem CID | 75259366 |
| Molecular Formula | C20H27FN4O |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | 2-[[3-(4-fluorophenyl)pyrazolidin-4-yl]methyl-(pyridin-4-ylmethyl)amino]butan-1-ol |
| SMILES | CCC(CO)N(Cc1ccncc1)CC1CNNC1c1ccc(F)cc1 |
| InChI | InChI=1S/C20H27FN4O/c1-2-19(14-26)25(12-15-7-9-22-10-8-15)13-17-11-23-24-20(17)16-3-5-18(21)6-4-16/h3-10,17,19-20,23-24,26H,2,11-14H2,1H3 |
| InChIKey | YXWWYJCPEPNRIQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |